C20H25BrClNO — CID 4716815
N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]hexan-1-amine (PubChem CID 4716815) has the molecular formula C20H25BrClNO and a molecular weight of 410.78 g/mol. Its IUPAC name is N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]hexan-1-amine.
| Compound Name | N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 4716815 |
| Molecular Formula | C20H25BrClNO |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1cc(Br)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H25BrClNO/c1-2-3-4-7-12-23-14-17-13-18(21)10-11-20(17)24-15-16-8-5-6-9-19(16)22/h5-6,8-11,13,23H,2-4,7,12,14-15H2,1H3 |
| InChIKey | JNRNAIZTUNHIJF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|