C17H20Cl3NO — CID 17290924
N-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine;hydrochloride (PubChem CID 17290924) has the molecular formula C17H20Cl3NO and a molecular weight of 360.71 g/mol. Its IUPAC name is N-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17290924 |
| Molecular Formula | C17H20Cl3NO |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1cc(Cl)ccc1OCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C17H19Cl2NO.ClH/c1-2-9-20-11-14-10-15(18)7-8-17(14)21-12-13-5-3-4-6-16(13)19;/h3-8,10,20H,2,9,11-12H2,1H3;1H |
| InChIKey | LAIAEPRKHZWMQT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|