C18H21Cl2NO3 — CID 17155290
2-[2-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol (PubChem CID 17155290) has the molecular formula C18H21Cl2NO3 and a molecular weight of 370.28 g/mol. Its IUPAC name is 2-[2-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 17155290 |
| Molecular Formula | C18H21Cl2NO3 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-[2-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol |
| SMILES | OCCOCCNCc1cc(Cl)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C18H21Cl2NO3/c19-16-5-6-18(24-13-14-3-1-2-4-17(14)20)15(11-16)12-21-7-9-23-10-8-22/h1-6,11,21-22H,7-10,12-13H2 |
| InChIKey | OVBMXVXRKARWEP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|