C18H21Cl4NO3 — CID 17155291
2-[2-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol;hydrochloride (PubChem CID 17155291) has the molecular formula C18H21Cl4NO3 and a molecular weight of 441.18 g/mol. Its IUPAC name is 2-[2-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol;hydrochloride.
| Compound Name | 2-[2-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17155291 |
| Molecular Formula | C18H21Cl4NO3 |
| Molecular Weight | 441.18 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-[2-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol;hydrochloride |
| SMILES | Cl.OCCOCCNCc1cc(Cl)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl3NO3.ClH/c19-15-3-4-18(14(9-15)11-22-5-7-24-8-6-23)25-12-13-1-2-16(20)10-17(13)21;/h1-4,9-10,22-23H,5-8,11-12H2;1H |
| InChIKey | XOLRGPKMJPPCOI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.18 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|