C16H17Cl2NO2 — CID 111457819
2-[2-[[(2,4-dichlorophenyl)methylamino]methyl]phenoxy]ethanol (PubChem CID 111457819) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 2-[2-[[(2,4-dichlorophenyl)methylamino]methyl]phenoxy]ethanol.
| Compound Name | 2-[2-[[(2,4-dichlorophenyl)methylamino]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 111457819 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-[2-[[(2,4-dichlorophenyl)methylamino]methyl]phenoxy]ethanol |
| SMILES | OCCOc1ccccc1CNCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2NO2/c17-14-6-5-12(15(18)9-14)10-19-11-13-3-1-2-4-16(13)21-8-7-20/h1-6,9,19-20H,7-8,10-11H2 |
| InChIKey | XYGIRKYIFRDBHV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |