C19H26Cl4N2O2 — CID 17295476
1-[2-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride (PubChem CID 17295476) has the molecular formula C19H26Cl4N2O2 and a molecular weight of 456.24 g/mol. Its IUPAC name is 1-[2-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride.
| Compound Name | 1-[2-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 17295476 |
| Molecular Formula | C19H26Cl4N2O2 |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 1-[2-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride |
| SMILES | CC(O)CNCCNCc1cc(Cl)ccc1OCc1ccccc1Cl.Cl.Cl |
| InChI | InChI=1S/C19H24Cl2N2O2.2ClH/c1-14(24)11-22-8-9-23-12-16-10-17(20)6-7-19(16)25-13-15-4-2-3-5-18(15)21;;/h2-7,10,14,22-24H,8-9,11-13H2,1H3;2*1H |
| InChIKey | ATRASNQCUQQGBP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|