C17H19ClFNO2 — CID 51996946
(2R)-1-[[2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylamino]propan-2-ol (PubChem CID 51996946) has the molecular formula C17H19ClFNO2 and a molecular weight of 323.80 g/mol. Its IUPAC name is (2R)-1-[[2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylamino]propan-2-ol.
| Compound Name | (2R)-1-[[2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 51996946 |
| Molecular Formula | C17H19ClFNO2 |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2R)-1-[[2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCc1ccccc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H19ClFNO2/c1-12(21)9-20-10-13-4-2-3-5-17(13)22-11-14-6-7-15(19)8-16(14)18/h2-8,12,20-21H,9-11H2,1H3/t12-/m1/s1 |
| InChIKey | JXNOSFCZORALTE-GFCCVEGCSA-N |
| XLogP | 3.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |