C19H22Cl2FNO3 — CID 66531708
1-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propan-2-ol (PubChem CID 66531708) has the molecular formula C19H22Cl2FNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is 1-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propan-2-ol.
| Compound Name | 1-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 66531708 |
| Molecular Formula | C19H22Cl2FNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propan-2-ol |
| SMILES | CCOc1cc(CNCC(C)O)c(Cl)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H22Cl2FNO3/c1-3-25-18-6-14(10-23-9-12(2)24)17(21)8-19(18)26-11-13-4-5-15(22)7-16(13)20/h4-8,12,23-24H,3,9-11H2,1-2H3 |
| InChIKey | AVQYYIVMTPVABH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |