C19H22Cl2FNO2 — CID 66531623
N-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]propan-2-amine (PubChem CID 66531623) has the molecular formula C19H22Cl2FNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]propan-2-amine.
| Compound Name | N-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66531623 |
| Molecular Formula | C19H22Cl2FNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]propan-2-amine |
| SMILES | CCOc1cc(CNC(C)C)c(Cl)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H22Cl2FNO2/c1-4-24-18-7-14(10-23-12(2)3)17(21)9-19(18)25-11-13-5-6-15(22)8-16(13)20/h5-9,12,23H,4,10-11H2,1-3H3 |
| InChIKey | YRWWOJXUCJQOTE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |