C19H23ClFNO3 — CID 66531113
1-[[2-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]propan-2-ol (PubChem CID 66531113) has the molecular formula C19H23ClFNO3 and a molecular weight of 367.85 g/mol. Its IUPAC name is 1-[[2-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]propan-2-ol.
| Compound Name | 1-[[2-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 66531113 |
| Molecular Formula | C19H23ClFNO3 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[[2-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]propan-2-ol |
| SMILES | CCOc1cc(CNCC(C)O)c(Cl)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H23ClFNO3/c1-3-24-18-8-15(11-22-10-13(2)23)17(20)9-19(18)25-12-14-4-6-16(21)7-5-14/h4-9,13,22-23H,3,10-12H2,1-2H3 |
| InChIKey | DJGTYSYVRMFENZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |