C24H23ClFNO4 — CID 66531122
4-[[[2-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]methyl]benzoic acid (PubChem CID 66531122) has the molecular formula C24H23ClFNO4 and a molecular weight of 443.90 g/mol. Its IUPAC name is 4-[[[2-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[2-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 66531122 |
| Molecular Formula | C24H23ClFNO4 |
| Molecular Weight | 443.90 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-[[[2-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylamino]methyl]benzoic acid |
| SMILES | CCOc1cc(CNCc2ccc(C(=O)O)cc2)c(Cl)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H23ClFNO4/c1-2-30-22-11-19(14-27-13-16-3-7-18(8-4-16)24(28)29)21(25)12-23(22)31-15-17-5-9-20(26)10-6-17/h3-12,27H,2,13-15H2,1H3,(H,28,29) |
| InChIKey | XPWHYDGVAAVPQS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.90 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |