C19H22BrNO4 — CID 66533958
4-[[(2-bromo-4,5-diethoxyphenyl)methylamino]methyl]benzoic acid (PubChem CID 66533958) has the molecular formula C19H22BrNO4 and a molecular weight of 408.29 g/mol. Its IUPAC name is 4-[[(2-bromo-4,5-diethoxyphenyl)methylamino]methyl]benzoic acid.
| Compound Name | 4-[[(2-bromo-4,5-diethoxyphenyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 66533958 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 4-[[(2-bromo-4,5-diethoxyphenyl)methylamino]methyl]benzoic acid |
| SMILES | CCOc1cc(Br)c(CNCc2ccc(C(=O)O)cc2)cc1OCC |
| InChI | InChI=1S/C19H22BrNO4/c1-3-24-17-9-15(16(20)10-18(17)25-4-2)12-21-11-13-5-7-14(8-6-13)19(22)23/h5-10,21H,3-4,11-12H2,1-2H3,(H,22,23) |
| InChIKey | ZLSWVSYKWVNMBQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |