C24H23BrClNO4 — CID 4720564
4-[[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]methyl]benzoic acid (PubChem CID 4720564) has the molecular formula C24H23BrClNO4 and a molecular weight of 504.81 g/mol. Its IUPAC name is 4-[[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 4720564 |
| Molecular Formula | C24H23BrClNO4 |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 4-[[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]methyl]benzoic acid |
| SMILES | CCOc1cc(CNCc2ccc(C(=O)O)cc2)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23BrClNO4/c1-2-30-22-12-18(14-27-13-16-3-7-19(8-4-16)24(28)29)11-21(25)23(22)31-15-17-5-9-20(26)10-6-17/h3-12,27H,2,13-15H2,1H3,(H,28,29) |
| InChIKey | FYDBIHZTYRQXOT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |