C21H28BrClN2O2 — CID 17215494
N'-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N-ethylpropane-1,3-diamine (PubChem CID 17215494) has the molecular formula C21H28BrClN2O2 and a molecular weight of 455.82 g/mol. Its IUPAC name is N'-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17215494 |
| Molecular Formula | C21H28BrClN2O2 |
| Molecular Weight | 455.82 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N'-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1cc(Br)c(OCc2ccc(Cl)cc2)c(OCC)c1 |
| InChI | InChI=1S/C21H28BrClN2O2/c1-3-24-10-5-11-25-14-17-12-19(22)21(20(13-17)26-4-2)27-15-16-6-8-18(23)9-7-16/h6-9,12-13,24-25H,3-5,10-11,14-15H2,1-2H3 |
| InChIKey | FABBYZJTGMNYAZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.82 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|