C23H21BrClNO4 — CID 66534210
4-[[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]methyl]benzoic acid (PubChem CID 66534210) has the molecular formula C23H21BrClNO4 and a molecular weight of 490.78 g/mol. Its IUPAC name is 4-[[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 66534210 |
| Molecular Formula | C23H21BrClNO4 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 4-[[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]methyl]benzoic acid |
| SMILES | COc1cc(CNCc2ccc(C(=O)O)cc2)c(Br)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C23H21BrClNO4/c1-29-21-10-18(13-26-12-15-6-8-16(9-7-15)23(27)28)19(24)11-22(21)30-14-17-4-2-3-5-20(17)25/h2-11,26H,12-14H2,1H3,(H,27,28) |
| InChIKey | AZEPUYDMOYDCDM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |