C21H17BrCl3NO3 — CID 66545053
4-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-2,6-dichlorophenol (PubChem CID 66545053) has the molecular formula C21H17BrCl3NO3 and a molecular weight of 517.63 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-2,6-dichlorophenol.
| Compound Name | 4-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 66545053 |
| Molecular Formula | C21H17BrCl3NO3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | 4-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-2,6-dichlorophenol |
| SMILES | COc1cc(CNc2cc(Cl)c(O)c(Cl)c2)c(Br)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C21H17BrCl3NO3/c1-28-19-6-13(10-26-14-7-17(24)21(27)18(25)8-14)15(22)9-20(19)29-11-12-4-2-3-5-16(12)23/h2-9,26-27H,10-11H2,1H3 |
| InChIKey | XOTMAVNLSQRSIS-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|