C23H23BrClNO3 — CID 66545038
N-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-chloro-4-methoxyaniline (PubChem CID 66545038) has the molecular formula C23H23BrClNO3 and a molecular weight of 476.80 g/mol. Its IUPAC name is N-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-chloro-4-methoxyaniline.
| Compound Name | N-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-chloro-4-methoxyaniline |
|---|---|
| PubChem CID | 66545038 |
| Molecular Formula | C23H23BrClNO3 |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | N-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-chloro-4-methoxyaniline |
| SMILES | COc1ccc(NCc2cc(OC)c(OCc3ccccc3C)cc2Br)cc1Cl |
| InChI | InChI=1S/C23H23BrClNO3/c1-15-6-4-5-7-16(15)14-29-23-12-19(24)17(10-22(23)28-3)13-26-18-8-9-21(27-2)20(25)11-18/h4-12,26H,13-14H2,1-3H3 |
| InChIKey | LDOOJRPZWIUUEN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|