C23H22Cl3NO3 — CID 66542482
3-chloro-N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-methoxyaniline (PubChem CID 66542482) has the molecular formula C23H22Cl3NO3 and a molecular weight of 466.79 g/mol. Its IUPAC name is 3-chloro-N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-methoxyaniline.
| Compound Name | 3-chloro-N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 66542482 |
| Molecular Formula | C23H22Cl3NO3 |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 3-chloro-N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-methoxyaniline |
| SMILES | CCOc1cc(CNc2ccc(OC)c(Cl)c2)c(Cl)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C23H22Cl3NO3/c1-3-29-22-10-16(13-27-17-8-9-21(28-2)20(26)11-17)19(25)12-23(22)30-14-15-6-4-5-7-18(15)24/h4-12,27H,3,13-14H2,1-2H3 |
| InChIKey | YGBLSBCYNSINEE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|