C16H16Cl2FNO2 — CID 66541958
3-chloro-N-[(2-chloro-5-ethoxy-4-methoxyphenyl)methyl]-4-fluoroaniline (PubChem CID 66541958) has the molecular formula C16H16Cl2FNO2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-chloro-N-[(2-chloro-5-ethoxy-4-methoxyphenyl)methyl]-4-fluoroaniline.
| Compound Name | 3-chloro-N-[(2-chloro-5-ethoxy-4-methoxyphenyl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 66541958 |
| Molecular Formula | C16H16Cl2FNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-chloro-N-[(2-chloro-5-ethoxy-4-methoxyphenyl)methyl]-4-fluoroaniline |
| SMILES | CCOc1cc(CNc2ccc(F)c(Cl)c2)c(Cl)cc1OC |
| InChI | InChI=1S/C16H16Cl2FNO2/c1-3-22-16-6-10(12(17)8-15(16)21-2)9-20-11-4-5-14(19)13(18)7-11/h4-8,20H,3,9H2,1-2H3 |
| InChIKey | YOFRTNSJPPKTDZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |