C16H19ClN2O4S — CID 66542237
4-[(2-chloro-4-ethoxy-5-methoxyphenyl)methylamino]benzenesulfonamide (PubChem CID 66542237) has the molecular formula C16H19ClN2O4S and a molecular weight of 370.86 g/mol. Its IUPAC name is 4-[(2-chloro-4-ethoxy-5-methoxyphenyl)methylamino]benzenesulfonamide.
| Compound Name | 4-[(2-chloro-4-ethoxy-5-methoxyphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 66542237 |
| Molecular Formula | C16H19ClN2O4S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-[(2-chloro-4-ethoxy-5-methoxyphenyl)methylamino]benzenesulfonamide |
| SMILES | CCOc1cc(Cl)c(CNc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C16H19ClN2O4S/c1-3-23-16-9-14(17)11(8-15(16)22-2)10-19-12-4-6-13(7-5-12)24(18,20)21/h4-9,19H,3,10H2,1-2H3,(H2,18,20,21) |
| InChIKey | VKIWLWVDIURWKX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |