C20H24ClNO4 — CID 66542035
ethyl 4-[(2-chloro-4,5-diethoxyphenyl)methylamino]benzoate (PubChem CID 66542035) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-4,5-diethoxyphenyl)methylamino]benzoate.
| Compound Name | ethyl 4-[(2-chloro-4,5-diethoxyphenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 66542035 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | ethyl 4-[(2-chloro-4,5-diethoxyphenyl)methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NCc2cc(OCC)c(OCC)cc2Cl)cc1 |
| InChI | InChI=1S/C20H24ClNO4/c1-4-24-18-11-15(17(21)12-19(18)25-5-2)13-22-16-9-7-14(8-10-16)20(23)26-6-3/h7-12,22H,4-6,13H2,1-3H3 |
| InChIKey | WQQWKCJHEDKMJZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |