C19H22ClNO4 — CID 66541685
3-[(2-chloro-4,5-diethoxyphenyl)methylamino]-4-methylbenzoic acid (PubChem CID 66541685) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-diethoxyphenyl)methylamino]-4-methylbenzoic acid.
| Compound Name | 3-[(2-chloro-4,5-diethoxyphenyl)methylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 66541685 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-[(2-chloro-4,5-diethoxyphenyl)methylamino]-4-methylbenzoic acid |
| SMILES | CCOc1cc(Cl)c(CNc2cc(C(=O)O)ccc2C)cc1OCC |
| InChI | InChI=1S/C19H22ClNO4/c1-4-24-17-9-14(15(20)10-18(17)25-5-2)11-21-16-8-13(19(22)23)7-6-12(16)3/h6-10,21H,4-5,11H2,1-3H3,(H,22,23) |
| InChIKey | WUXAQOBVDXQQOJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |