C24H25NO4 — CID 17059209
3-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]-4-methylbenzoic acid (PubChem CID 17059209) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]-4-methylbenzoic acid.
| Compound Name | 3-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 17059209 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]-4-methylbenzoic acid |
| SMILES | CCOc1cc(CNc2cc(C(=O)O)ccc2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H25NO4/c1-3-28-23-13-19(10-12-22(23)29-16-18-7-5-4-6-8-18)15-25-21-14-20(24(26)27)11-9-17(21)2/h4-14,25H,3,15-16H2,1-2H3,(H,26,27) |
| InChIKey | VLDFUAXSMGHUDJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |