C24H25ClN2O3 — CID 66542397
N-[4-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]phenyl]acetamide (PubChem CID 66542397) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is N-[4-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]phenyl]acetamide.
| Compound Name | N-[4-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 66542397 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[4-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]phenyl]acetamide |
| SMILES | CCOc1cc(CNc2ccc(NC(C)=O)cc2)c(Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H25ClN2O3/c1-3-29-23-13-19(15-26-20-9-11-21(12-10-20)27-17(2)28)22(25)14-24(23)30-16-18-7-5-4-6-8-18/h4-14,26H,3,15-16H2,1-2H3,(H,27,28) |
| InChIKey | PXCCNCUXDWHCKU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |