C27H31ClN2O3 — CID 66542672
N-[3-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]phenyl]-3-methylbutanamide (PubChem CID 66542672) has the molecular formula C27H31ClN2O3 and a molecular weight of 467.01 g/mol. Its IUPAC name is N-[3-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 66542672 |
| Molecular Formula | C27H31ClN2O3 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[3-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]phenyl]-3-methylbutanamide |
| SMILES | CCOc1cc(CNc2cccc(NC(=O)CC(C)C)c2)c(Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H31ClN2O3/c1-4-32-25-14-21(24(28)16-26(25)33-18-20-9-6-5-7-10-20)17-29-22-11-8-12-23(15-22)30-27(31)13-19(2)3/h5-12,14-16,19,29H,4,13,17-18H2,1-3H3,(H,30,31) |
| InChIKey | OPNWCOXPEWDAJR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |