C23H21Cl2NO4 — CID 66542751
2-chloro-4-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]benzoic acid (PubChem CID 66542751) has the molecular formula C23H21Cl2NO4 and a molecular weight of 446.33 g/mol. Its IUPAC name is 2-chloro-4-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]benzoic acid.
| Compound Name | 2-chloro-4-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 66542751 |
| Molecular Formula | C23H21Cl2NO4 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-chloro-4-[(2-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylamino]benzoic acid |
| SMILES | CCOc1cc(CNc2ccc(C(=O)O)c(Cl)c2)c(Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H21Cl2NO4/c1-2-29-21-10-16(13-26-17-8-9-18(23(27)28)20(25)11-17)19(24)12-22(21)30-14-15-6-4-3-5-7-15/h3-12,26H,2,13-14H2,1H3,(H,27,28) |
| InChIKey | SWWDHHPZFRQMSY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |