C24H24BrClN2O3 — CID 66542049
N-[4-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]phenyl]acetamide (PubChem CID 66542049) has the molecular formula C24H24BrClN2O3 and a molecular weight of 503.82 g/mol. Its IUPAC name is N-[4-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]phenyl]acetamide.
| Compound Name | N-[4-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 66542049 |
| Molecular Formula | C24H24BrClN2O3 |
| Molecular Weight | 503.82 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | N-[4-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]phenyl]acetamide |
| SMILES | CCOc1cc(CNc2ccc(NC(C)=O)cc2)c(Br)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24BrClN2O3/c1-3-30-23-12-18(14-27-20-8-10-21(11-9-20)28-16(2)29)22(25)13-24(23)31-15-17-4-6-19(26)7-5-17/h4-13,27H,3,14-15H2,1-2H3,(H,28,29) |
| InChIKey | OMSYETDWGVWUGA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.82 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |