C22H19BrCl2FNO2 — CID 66541264
N-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-chloroaniline (PubChem CID 66541264) has the molecular formula C22H19BrCl2FNO2 and a molecular weight of 499.21 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-chloroaniline.
| Compound Name | N-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-chloroaniline |
|---|---|
| PubChem CID | 66541264 |
| Molecular Formula | C22H19BrCl2FNO2 |
| Molecular Weight | 499.21 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | N-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-chloroaniline |
| SMILES | CCOc1cc(CNc2ccc(Cl)cc2)c(Br)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C22H19BrCl2FNO2/c1-2-28-21-10-14(12-27-16-8-6-15(24)7-9-16)18(23)11-22(21)29-13-17-19(25)4-3-5-20(17)26/h3-11,27H,2,12-13H2,1H3 |
| InChIKey | JXFRKDBVHCSMPQ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.21 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |