C20H24BrClFNO4 — CID 66533707
2-[2-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethoxy]ethanol (PubChem CID 66533707) has the molecular formula C20H24BrClFNO4 and a molecular weight of 476.77 g/mol. Its IUPAC name is 2-[2-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 66533707 |
| Molecular Formula | C20H24BrClFNO4 |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-[2-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethoxy]ethanol |
| SMILES | CCOc1cc(CNCCOCCO)c(Br)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H24BrClFNO4/c1-2-27-19-10-14(12-24-6-8-26-9-7-25)16(21)11-20(19)28-13-15-17(22)4-3-5-18(15)23/h3-5,10-11,24-25H,2,6-9,12-13H2,1H3 |
| InChIKey | OUMZLMCYVHWYBB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|