C23H27BrClFN2O3 — CID 66533628
1-[3-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propyl]pyrrolidin-2-one (PubChem CID 66533628) has the molecular formula C23H27BrClFN2O3 and a molecular weight of 513.84 g/mol. Its IUPAC name is 1-[3-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 66533628 |
| Molecular Formula | C23H27BrClFN2O3 |
| Molecular Weight | 513.84 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 1-[3-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propyl]pyrrolidin-2-one |
| SMILES | CCOc1cc(CNCCCN2CCCC2=O)c(Br)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H27BrClFN2O3/c1-2-30-21-12-16(14-27-9-5-11-28-10-4-8-23(28)29)18(24)13-22(21)31-15-17-19(25)6-3-7-20(17)26/h3,6-7,12-13,27H,2,4-5,8-11,14-15H2,1H3 |
| InChIKey | SJFVULJLYPVTGJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.84 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|