C22H26BrFN2O3 — CID 66534802
1-[3-[[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one (PubChem CID 66534802) has the molecular formula C22H26BrFN2O3 and a molecular weight of 465.36 g/mol. Its IUPAC name is 1-[3-[[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 66534802 |
| Molecular Formula | C22H26BrFN2O3 |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-[3-[[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one |
| SMILES | COc1cc(CNCCCN2CCCC2=O)c(Br)cc1OCc1ccccc1F |
| InChI | InChI=1S/C22H26BrFN2O3/c1-28-20-12-17(14-25-9-5-11-26-10-4-8-22(26)27)18(23)13-21(20)29-15-16-6-2-3-7-19(16)24/h2-3,6-7,12-13,25H,4-5,8-11,14-15H2,1H3 |
| InChIKey | ODHQLQKBXMVDDU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|