C20H22ClFN2O2 — CID 11245857
1-[2-[[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethyl]pyrrolidin-2-one (PubChem CID 11245857) has the molecular formula C20H22ClFN2O2 and a molecular weight of 376.86 g/mol. Its IUPAC name is 1-[2-[[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11245857 |
| Molecular Formula | C20H22ClFN2O2 |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[2-[[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCNCc1ccc(OCc2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClFN2O2/c21-17-12-15(13-23-9-11-24-10-3-6-20(24)25)7-8-19(17)26-14-16-4-1-2-5-18(16)22/h1-2,4-5,7-8,12,23H,3,6,9-11,13-14H2 |
| InChIKey | OOWDPWKFAYKKHY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|