C23H26BrClFNO2 — CID 66535369
N-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(cyclohexen-1-yl)ethanamine (PubChem CID 66535369) has the molecular formula C23H26BrClFNO2 and a molecular weight of 482.82 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(cyclohexen-1-yl)ethanamine.
| Compound Name | N-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(cyclohexen-1-yl)ethanamine |
|---|---|
| PubChem CID | 66535369 |
| Molecular Formula | C23H26BrClFNO2 |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | N-[[2-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(cyclohexen-1-yl)ethanamine |
| SMILES | COc1cc(CNCCC2=CCCCC2)c(Br)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H26BrClFNO2/c1-28-22-12-17(14-27-11-10-16-6-3-2-4-7-16)19(24)13-23(22)29-15-18-20(25)8-5-9-21(18)26/h5-6,8-9,12-13,27H,2-4,7,10-11,14-15H2,1H3 |
| InChIKey | UXZMJXUGYPVFOE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|