C19H28BrNO2 — CID 66535550
N-[(2-bromo-5-methoxy-4-propoxyphenyl)methyl]-2-(cyclohexen-1-yl)ethanamine (PubChem CID 66535550) has the molecular formula C19H28BrNO2 and a molecular weight of 382.34 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxy-4-propoxyphenyl)methyl]-2-(cyclohexen-1-yl)ethanamine.
| Compound Name | N-[(2-bromo-5-methoxy-4-propoxyphenyl)methyl]-2-(cyclohexen-1-yl)ethanamine |
|---|---|
| PubChem CID | 66535550 |
| Molecular Formula | C19H28BrNO2 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[(2-bromo-5-methoxy-4-propoxyphenyl)methyl]-2-(cyclohexen-1-yl)ethanamine |
| SMILES | CCCOc1cc(Br)c(CNCCC2=CCCCC2)cc1OC |
| InChI | InChI=1S/C19H28BrNO2/c1-3-11-23-19-13-17(20)16(12-18(19)22-2)14-21-10-9-15-7-5-4-6-8-15/h7,12-13,21H,3-6,8-11,14H2,1-2H3 |
| InChIKey | JCVSQLWAOOPZIK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|