C19H24BrNO3 — CID 22081240
4-bromo-2-methoxy-5-[[2-(4-propoxyphenyl)ethylamino]methyl]phenol (PubChem CID 22081240) has the molecular formula C19H24BrNO3 and a molecular weight of 394.31 g/mol. Its IUPAC name is 4-bromo-2-methoxy-5-[[2-(4-propoxyphenyl)ethylamino]methyl]phenol.
| Compound Name | 4-bromo-2-methoxy-5-[[2-(4-propoxyphenyl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 22081240 |
| Molecular Formula | C19H24BrNO3 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 4-bromo-2-methoxy-5-[[2-(4-propoxyphenyl)ethylamino]methyl]phenol |
| SMILES | CCCOc1ccc(CCNCc2cc(O)c(OC)cc2Br)cc1 |
| InChI | InChI=1S/C19H24BrNO3/c1-3-10-24-16-6-4-14(5-7-16)8-9-21-13-15-11-18(22)19(23-2)12-17(15)20/h4-7,11-12,21-22H,3,8-10,13H2,1-2H3 |
| InChIKey | GRLWUELCLFEKRO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|