C21H28BrNO3 — CID 66533900
N-[(2-bromo-5-ethoxy-4-propoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine (PubChem CID 66533900) has the molecular formula C21H28BrNO3 and a molecular weight of 422.36 g/mol. Its IUPAC name is N-[(2-bromo-5-ethoxy-4-propoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine.
| Compound Name | N-[(2-bromo-5-ethoxy-4-propoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66533900 |
| Molecular Formula | C21H28BrNO3 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[(2-bromo-5-ethoxy-4-propoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine |
| SMILES | CCCOc1cc(Br)c(CNCCc2ccccc2OC)cc1OCC |
| InChI | InChI=1S/C21H28BrNO3/c1-4-12-26-21-14-18(22)17(13-20(21)25-5-2)15-23-11-10-16-8-6-7-9-19(16)24-3/h6-9,13-14,23H,4-5,10-12,15H2,1-3H3 |
| InChIKey | OGIMELQZRIACIQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|