C19H25BrClNO3 — CID 17207346
N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17207346) has the molecular formula C19H25BrClNO3 and a molecular weight of 430.77 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17207346 |
| Molecular Formula | C19H25BrClNO3 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2ccccc2OC)cc(Br)c1OC.Cl |
| InChI | InChI=1S/C19H24BrNO3.ClH/c1-4-24-18-12-14(11-16(20)19(18)23-3)13-21-10-9-15-7-5-6-8-17(15)22-2;/h5-8,11-12,21H,4,9-10,13H2,1-3H3;1H |
| InChIKey | XCDRNKOVFFYOLW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|