C13H21BrClNO3 — CID 17295767
N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride (PubChem CID 17295767) has the molecular formula C13H21BrClNO3 and a molecular weight of 354.67 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride.
| Compound Name | N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride |
|---|---|
| PubChem CID | 17295767 |
| Molecular Formula | C13H21BrClNO3 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCOC)cc(Br)c1OC.Cl |
| InChI | InChI=1S/C13H20BrNO3.ClH/c1-4-18-12-8-10(9-15-5-6-16-2)7-11(14)13(12)17-3;/h7-8,15H,4-6,9H2,1-3H3;1H |
| InChIKey | IZCTVWVSTMHSMB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|