C16H26BrNO3 — CID 63057850
N-[[3-bromo-5-methoxy-4-(3-methylbutoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 63057850) has the molecular formula C16H26BrNO3 and a molecular weight of 360.29 g/mol. Its IUPAC name is N-[[3-bromo-5-methoxy-4-(3-methylbutoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-bromo-5-methoxy-4-(3-methylbutoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63057850 |
| Molecular Formula | C16H26BrNO3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[[3-bromo-5-methoxy-4-(3-methylbutoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(Br)c(OCCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C16H26BrNO3/c1-12(2)5-7-21-16-14(17)9-13(10-15(16)20-4)11-18-6-8-19-3/h9-10,12,18H,5-8,11H2,1-4H3 |
| InChIKey | AKTMBLYOPCTBSN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|