C13H20BrNO4 — CID 55218721
2-[2-bromo-6-methoxy-4-[(2-methoxyethylamino)methyl]phenoxy]ethanol (PubChem CID 55218721) has the molecular formula C13H20BrNO4 and a molecular weight of 334.21 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(2-methoxyethylamino)methyl]phenoxy]ethanol.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(2-methoxyethylamino)methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 55218721 |
| Molecular Formula | C13H20BrNO4 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(2-methoxyethylamino)methyl]phenoxy]ethanol |
| SMILES | COCCNCc1cc(Br)c(OCCO)c(OC)c1 |
| InChI | InChI=1S/C13H20BrNO4/c1-17-5-3-15-9-10-7-11(14)13(19-6-4-16)12(8-10)18-2/h7-8,15-16H,3-6,9H2,1-2H3 |
| InChIKey | OZLOZRMPDCGLPF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|