C13H21BrClNO4 — CID 17155495
2-[2-[(3-bromo-4,5-dimethoxyphenyl)methylamino]ethoxy]ethanol;hydrochloride (PubChem CID 17155495) has the molecular formula C13H21BrClNO4 and a molecular weight of 370.67 g/mol. Its IUPAC name is 2-[2-[(3-bromo-4,5-dimethoxyphenyl)methylamino]ethoxy]ethanol;hydrochloride.
| Compound Name | 2-[2-[(3-bromo-4,5-dimethoxyphenyl)methylamino]ethoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17155495 |
| Molecular Formula | C13H21BrClNO4 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2-[2-[(3-bromo-4,5-dimethoxyphenyl)methylamino]ethoxy]ethanol;hydrochloride |
| SMILES | COc1cc(CNCCOCCO)cc(Br)c1OC.Cl |
| InChI | InChI=1S/C13H20BrNO4.ClH/c1-17-12-8-10(7-11(14)13(12)18-2)9-15-3-5-19-6-4-16;/h7-8,15-16H,3-6,9H2,1-2H3;1H |
| InChIKey | YKJBUTBAAZSILM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|