C13H20BrNO4 — CID 54917908
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,2-dimethoxyethanamine (PubChem CID 54917908) has the molecular formula C13H20BrNO4 and a molecular weight of 334.21 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,2-dimethoxyethanamine.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 54917908 |
| Molecular Formula | C13H20BrNO4 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,2-dimethoxyethanamine |
| SMILES | COc1cc(CNCC(OC)OC)cc(Br)c1OC |
| InChI | InChI=1S/C13H20BrNO4/c1-16-11-6-9(5-10(14)13(11)19-4)7-15-8-12(17-2)18-3/h5-6,12,15H,7-8H2,1-4H3 |
| InChIKey | JTDUYCNWQXGBLT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|