C11H15Br2NO2 — CID 43770585
3-[(3,5-dibromo-4-methoxyphenyl)methylamino]propan-1-ol (PubChem CID 43770585) has the molecular formula C11H15Br2NO2 and a molecular weight of 353.05 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-methoxyphenyl)methylamino]propan-1-ol.
| Compound Name | 3-[(3,5-dibromo-4-methoxyphenyl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 43770585 |
| Molecular Formula | C11H15Br2NO2 |
| Molecular Weight | 353.05 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 3-[(3,5-dibromo-4-methoxyphenyl)methylamino]propan-1-ol |
| SMILES | COc1c(Br)cc(CNCCCO)cc1Br |
| InChI | InChI=1S/C11H15Br2NO2/c1-16-11-9(12)5-8(6-10(11)13)7-14-3-2-4-15/h5-6,14-15H,2-4,7H2,1H3 |
| InChIKey | RDFYCGLYMMXVMJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.05 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|