C12H17Br2NO2 — CID 43220362
3-[(3,5-dibromo-4-ethoxyphenyl)methylamino]propan-1-ol (PubChem CID 43220362) has the molecular formula C12H17Br2NO2 and a molecular weight of 367.08 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-ethoxyphenyl)methylamino]propan-1-ol.
| Compound Name | 3-[(3,5-dibromo-4-ethoxyphenyl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 43220362 |
| Molecular Formula | C12H17Br2NO2 |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 3-[(3,5-dibromo-4-ethoxyphenyl)methylamino]propan-1-ol |
| SMILES | CCOc1c(Br)cc(CNCCCO)cc1Br |
| InChI | InChI=1S/C12H17Br2NO2/c1-2-17-12-10(13)6-9(7-11(12)14)8-15-4-3-5-16/h6-7,15-16H,2-5,8H2,1H3 |
| InChIKey | JASPPQLBTXHOJP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|