C14H22Br2N2O — CID 17159816
N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 17159816) has the molecular formula C14H22Br2N2O and a molecular weight of 394.15 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17159816 |
| Molecular Formula | C14H22Br2N2O |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCOc1c(Br)cc(CNCCCN(C)C)cc1Br |
| InChI | InChI=1S/C14H22Br2N2O/c1-4-19-14-12(15)8-11(9-13(14)16)10-17-6-5-7-18(2)3/h8-9,17H,4-7,10H2,1-3H3 |
| InChIKey | UNQFOFWBBXCWAL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|