C15H25BrClNO2 — CID 17292240
N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]pentan-1-amine;hydrochloride (PubChem CID 17292240) has the molecular formula C15H25BrClNO2 and a molecular weight of 366.73 g/mol. Its IUPAC name is N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]pentan-1-amine;hydrochloride.
| Compound Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17292240 |
| Molecular Formula | C15H25BrClNO2 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]pentan-1-amine;hydrochloride |
| SMILES | CCCCCNCc1cc(Br)c(OCC)c(OC)c1.Cl |
| InChI | InChI=1S/C15H24BrNO2.ClH/c1-4-6-7-8-17-11-12-9-13(16)15(19-5-2)14(10-12)18-3;/h9-10,17H,4-8,11H2,1-3H3;1H |
| InChIKey | YFFKMWYMVBIAQB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|