C18H33BrCl2N2O2 — CID 17215126
N-[(3-bromo-4,5-diethoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215126) has the molecular formula C18H33BrCl2N2O2 and a molecular weight of 460.28 g/mol. Its IUPAC name is N-[(3-bromo-4,5-diethoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[(3-bromo-4,5-diethoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215126 |
| Molecular Formula | C18H33BrCl2N2O2 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-[(3-bromo-4,5-diethoxyphenyl)methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCOc1cc(CNCCCN(CC)CC)cc(Br)c1OCC.Cl.Cl |
| InChI | InChI=1S/C18H31BrN2O2.2ClH/c1-5-21(6-2)11-9-10-20-14-15-12-16(19)18(23-8-4)17(13-15)22-7-3;;/h12-13,20H,5-11,14H2,1-4H3;2*1H |
| InChIKey | MYOSZBCXMAKOLQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|