C11H14Br2O2 — CID 43627282
1-bromo-5-(bromomethyl)-2,3-diethoxybenzene (PubChem CID 43627282) has the molecular formula C11H14Br2O2 and a molecular weight of 338.04 g/mol. Its IUPAC name is 1-bromo-5-(bromomethyl)-2,3-diethoxybenzene.
| Compound Name | 1-bromo-5-(bromomethyl)-2,3-diethoxybenzene |
|---|---|
| PubChem CID | 43627282 |
| Molecular Formula | C11H14Br2O2 |
| Molecular Weight | 338.04 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 1-bromo-5-(bromomethyl)-2,3-diethoxybenzene |
| SMILES | CCOc1cc(CBr)cc(Br)c1OCC |
| InChI | InChI=1S/C11H14Br2O2/c1-3-14-10-6-8(7-12)5-9(13)11(10)15-4-2/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | NIOURPWKXHHJLX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.04 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|