C15H20Br2O3 — CID 103135379
2-[[2-bromo-4-(bromomethyl)-6-ethoxyphenoxy]methyl]-5-methyloxolane (PubChem CID 103135379) has the molecular formula C15H20Br2O3 and a molecular weight of 408.13 g/mol. Its IUPAC name is 2-[[2-bromo-4-(bromomethyl)-6-ethoxyphenoxy]methyl]-5-methyloxolane.
| Compound Name | 2-[[2-bromo-4-(bromomethyl)-6-ethoxyphenoxy]methyl]-5-methyloxolane |
|---|---|
| PubChem CID | 103135379 |
| Molecular Formula | C15H20Br2O3 |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 2-[[2-bromo-4-(bromomethyl)-6-ethoxyphenoxy]methyl]-5-methyloxolane |
| SMILES | CCOc1cc(CBr)cc(Br)c1OCC1CCC(C)O1 |
| InChI | InChI=1S/C15H20Br2O3/c1-3-18-14-7-11(8-16)6-13(17)15(14)19-9-12-5-4-10(2)20-12/h6-7,10,12H,3-5,8-9H2,1-2H3 |
| InChIKey | LTKDVIUJOUPWFF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|