C13H15BrF2O2 — CID 103135410
2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-5-methyloxolane (PubChem CID 103135410) has the molecular formula C13H15BrF2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-5-methyloxolane.
| Compound Name | 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-5-methyloxolane |
|---|---|
| PubChem CID | 103135410 |
| Molecular Formula | C13H15BrF2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-5-methyloxolane |
| SMILES | CC1CCC(COc2c(F)cc(CBr)cc2F)O1 |
| InChI | InChI=1S/C13H15BrF2O2/c1-8-2-3-10(18-8)7-17-13-11(15)4-9(6-14)5-12(13)16/h4-5,8,10H,2-3,6-7H2,1H3 |
| InChIKey | OLBODYCNXASXHJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|